C13H17FINO3 — CID 68754951
tert-butyl N-[(1S)-1-(3-fluorophenyl)-2-hydroxy-1-iodoethyl]carbamate (PubChem CID 68754951) has the molecular formula C13H17FINO3 and a molecular weight of 381.19 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(3-fluorophenyl)-2-hydroxy-1-iodoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(3-fluorophenyl)-2-hydroxy-1-iodoethyl]carbamate |
|---|---|
| PubChem CID | 68754951 |
| Molecular Formula | C13H17FINO3 |
| Molecular Weight | 381.19 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | tert-butyl N-[(1S)-1-(3-fluorophenyl)-2-hydroxy-1-iodoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@](I)(CO)c1cccc(F)c1 |
| InChI | InChI=1S/C13H17FINO3/c1-12(2,3)19-11(18)16-13(15,8-17)9-5-4-6-10(14)7-9/h4-7,17H,8H2,1-3H3,(H,16,18)/t13-/m0/s1 |
| InChIKey | UCKWCWSJJFHOFA-ZDUSSCGKSA-N |
| XLogP | 2.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|