C20H25NO3 — CID 69174431
tert-butyl N-[1-[3-(hydroxymethyl)phenyl]-1-phenylethyl]carbamate (PubChem CID 69174431) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(hydroxymethyl)phenyl]-1-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(hydroxymethyl)phenyl]-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 69174431 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | tert-butyl N-[1-[3-(hydroxymethyl)phenyl]-1-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(c1ccccc1)c1cccc(CO)c1 |
| InChI | InChI=1S/C20H25NO3/c1-19(2,3)24-18(23)21-20(4,16-10-6-5-7-11-16)17-12-8-9-15(13-17)14-22/h5-13,22H,14H2,1-4H3,(H,21,23) |
| InChIKey | HUASGIPDDNKMBQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |