C13H27NO4 — CID 163443382
tert-butyl N-[3-hydroxy-2-(hydroxymethyl)-2-methylhexyl]carbamate (PubChem CID 163443382) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-2-(hydroxymethyl)-2-methylhexyl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-2-(hydroxymethyl)-2-methylhexyl]carbamate |
|---|---|
| PubChem CID | 163443382 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | tert-butyl N-[3-hydroxy-2-(hydroxymethyl)-2-methylhexyl]carbamate |
| SMILES | CCCC(O)C(C)(CO)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H27NO4/c1-6-7-10(16)13(5,9-15)8-14-11(17)18-12(2,3)4/h10,15-16H,6-9H2,1-5H3,(H,14,17) |
| InChIKey | BALSKGSOEMYXTA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |