C15H32N2O3 — CID 107248510
tert-butyl N-[2-[[2-ethyl-2-(hydroxymethyl)butyl]amino]propyl]carbamate (PubChem CID 107248510) has the molecular formula C15H32N2O3 and a molecular weight of 288.43 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-ethyl-2-(hydroxymethyl)butyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-ethyl-2-(hydroxymethyl)butyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 107248510 |
| Molecular Formula | C15H32N2O3 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | tert-butyl N-[2-[[2-ethyl-2-(hydroxymethyl)butyl]amino]propyl]carbamate |
| SMILES | CCC(CC)(CO)CNC(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H32N2O3/c1-7-15(8-2,11-18)10-17-12(3)9-16-13(19)20-14(4,5)6/h12,17-18H,7-11H2,1-6H3,(H,16,19) |
| InChIKey | WYNBRZFLBIYDDH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |