C17H26INO3 — CID 165493506
tert-butyl N-[3-iodo-2-methyl-2-(2-phenylethoxy)propyl]carbamate (PubChem CID 165493506) has the molecular formula C17H26INO3 and a molecular weight of 419.30 g/mol. Its IUPAC name is tert-butyl N-[3-iodo-2-methyl-2-(2-phenylethoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[3-iodo-2-methyl-2-(2-phenylethoxy)propyl]carbamate |
|---|---|
| PubChem CID | 165493506 |
| Molecular Formula | C17H26INO3 |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | tert-butyl N-[3-iodo-2-methyl-2-(2-phenylethoxy)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(CI)OCCc1ccccc1 |
| InChI | InChI=1S/C17H26INO3/c1-16(2,3)22-15(20)19-13-17(4,12-18)21-11-10-14-8-6-5-7-9-14/h5-9H,10-13H2,1-4H3,(H,19,20) |
| InChIKey | MBEIZYQFEUTSKB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|