C18H25NO3 — CID 44519711
tert-butyl N-(2-hydroxy-2-methyl-6-phenylhex-3-ynyl)carbamate (PubChem CID 44519711) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxy-2-methyl-6-phenylhex-3-ynyl)carbamate.
| Compound Name | tert-butyl N-(2-hydroxy-2-methyl-6-phenylhex-3-ynyl)carbamate |
|---|---|
| PubChem CID | 44519711 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | tert-butyl N-(2-hydroxy-2-methyl-6-phenylhex-3-ynyl)carbamate |
| SMILES | CC(O)(C#CCCc1ccccc1)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO3/c1-17(2,3)22-16(20)19-14-18(4,21)13-9-8-12-15-10-6-5-7-11-15/h5-7,10-11,21H,8,12,14H2,1-4H3,(H,19,20) |
| InChIKey | SPMDZOZFFUFHSN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|