C13H23BrF3NO3 — CID 114774784
tert-butyl N-[3-bromo-2-methyl-2-(4,4,4-trifluorobutoxy)propyl]carbamate (PubChem CID 114774784) has the molecular formula C13H23BrF3NO3 and a molecular weight of 378.23 g/mol. Its IUPAC name is tert-butyl N-[3-bromo-2-methyl-2-(4,4,4-trifluorobutoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[3-bromo-2-methyl-2-(4,4,4-trifluorobutoxy)propyl]carbamate |
|---|---|
| PubChem CID | 114774784 |
| Molecular Formula | C13H23BrF3NO3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | tert-butyl N-[3-bromo-2-methyl-2-(4,4,4-trifluorobutoxy)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(CBr)OCCCC(F)(F)F |
| InChI | InChI=1S/C13H23BrF3NO3/c1-11(2,3)21-10(19)18-9-12(4,8-14)20-7-5-6-13(15,16)17/h5-9H2,1-4H3,(H,18,19) |
| InChIKey | KIKIYLCUXIDERZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|