C9H15F2NO3 — CID 129292881
tert-butyl N-(2,2-difluoro-3-oxobutyl)carbamate (PubChem CID 129292881) has the molecular formula C9H15F2NO3 and a molecular weight of 223.22 g/mol. Its IUPAC name is tert-butyl N-(2,2-difluoro-3-oxobutyl)carbamate.
| Compound Name | tert-butyl N-(2,2-difluoro-3-oxobutyl)carbamate |
|---|---|
| PubChem CID | 129292881 |
| Molecular Formula | C9H15F2NO3 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | tert-butyl N-(2,2-difluoro-3-oxobutyl)carbamate |
| SMILES | CC(=O)C(F)(F)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H15F2NO3/c1-6(13)9(10,11)5-12-7(14)15-8(2,3)4/h5H2,1-4H3,(H,12,14) |
| InChIKey | VRVPAWGXBPJBGH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |