C13H21F2N2O3+ — CID 143038671
[(1Z,3Z)-6,6-difluoro-5-methylidene-7-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-1,3-dienyl]-hydroxyazanium (PubChem CID 143038671) has the molecular formula C13H21F2N2O3+ and a molecular weight of 291.32 g/mol. Its IUPAC name is [(1Z,3Z)-6,6-difluoro-5-methylidene-7-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-1,3-dienyl]-hydroxyazanium.
| Compound Name | [(1Z,3Z)-6,6-difluoro-5-methylidene-7-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-1,3-dienyl]-hydroxyazanium |
|---|---|
| PubChem CID | 143038671 |
| Molecular Formula | C13H21F2N2O3+ |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | [(1Z,3Z)-6,6-difluoro-5-methylidene-7-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-1,3-dienyl]-hydroxyazanium |
| SMILES | C=C(/C=C\C=C/[NH2+]O)C(F)(F)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20F2N2O3/c1-10(7-5-6-8-17-19)13(14,15)9-16-11(18)20-12(2,3)4/h5-8,17,19H,1,9H2,2-4H3,(H,16,18)/p+1/b7-5-,8-6- |
| InChIKey | RUTNSVCCUYBBPA-SFECMWDFSA-O |
| XLogP | 1.73 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|