C15H30BrNO3 — CID 147498058
tert-butyl N-[3-(3-bromo-2,2-dimethylpropoxy)-2,2-dimethylpropyl]carbamate (PubChem CID 147498058) has the molecular formula C15H30BrNO3 and a molecular weight of 352.31 g/mol. Its IUPAC name is tert-butyl N-[3-(3-bromo-2,2-dimethylpropoxy)-2,2-dimethylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-bromo-2,2-dimethylpropoxy)-2,2-dimethylpropyl]carbamate |
|---|---|
| PubChem CID | 147498058 |
| Molecular Formula | C15H30BrNO3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | tert-butyl N-[3-(3-bromo-2,2-dimethylpropoxy)-2,2-dimethylpropyl]carbamate |
| SMILES | CC(C)(CBr)COCC(C)(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30BrNO3/c1-13(2,3)20-12(18)17-9-15(6,7)11-19-10-14(4,5)8-16/h8-11H2,1-7H3,(H,17,18) |
| InChIKey | FGWHFWFGKQQHNR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|