C19H36N2O4S3 — CID 156545513
tert-butyl N-[2,2-dimethyl-3-[3-[(2-methyl-2-methylsulfanylcarbothioylsulfanylpropanoyl)amino]propoxy]propyl]carbamate (PubChem CID 156545513) has the molecular formula C19H36N2O4S3 and a molecular weight of 452.71 g/mol. Its IUPAC name is tert-butyl N-[2,2-dimethyl-3-[3-[(2-methyl-2-methylsulfanylcarbothioylsulfanylpropanoyl)amino]propoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[2,2-dimethyl-3-[3-[(2-methyl-2-methylsulfanylcarbothioylsulfanylpropanoyl)amino]propoxy]propyl]carbamate |
|---|---|
| PubChem CID | 156545513 |
| Molecular Formula | C19H36N2O4S3 |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | tert-butyl N-[2,2-dimethyl-3-[3-[(2-methyl-2-methylsulfanylcarbothioylsulfanylpropanoyl)amino]propoxy]propyl]carbamate |
| SMILES | CSC(=S)SC(C)(C)C(=O)NCCCOCC(C)(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H36N2O4S3/c1-17(2,3)25-15(23)21-12-18(4,5)13-24-11-9-10-20-14(22)19(6,7)28-16(26)27-8/h9-13H2,1-8H3,(H,20,22)(H,21,23) |
| InChIKey | UASDQIXDFOLBDF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|