C30H58N6O6S3 — CID 156545511
tert-butyl N-[3-[3-[[4-[[2-(2-azidoethoxy)ethylamino]-hydroxymethyl]-2,2,3-trimethyl-6-methylsulfanylcarbothioylsulfanylheptanoyl]amino]propoxy]-2,2-dimethylpropyl]carbamate (PubChem CID 156545511) has the molecular formula C30H58N6O6S3 and a molecular weight of 695.03 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[[4-[[2-(2-azidoethoxy)ethylamino]-hydroxymethyl]-2,2,3-trimethyl-6-methylsulfanylcarbothioylsulfanylheptanoyl]amino]propoxy]-2,2-dimethylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[[4-[[2-(2-azidoethoxy)ethylamino]-hydroxymethyl]-2,2,3-trimethyl-6-methylsulfanylcarbothioylsulfanylheptanoyl]amino]propoxy]-2,2-dimethylpropyl]carbamate |
|---|---|
| PubChem CID | 156545511 |
| Molecular Formula | C30H58N6O6S3 |
| Molecular Weight | 695.03 g/mol |
| Exact Mass | 694.36 |
| IUPAC Name | tert-butyl N-[3-[3-[[4-[[2-(2-azidoethoxy)ethylamino]-hydroxymethyl]-2,2,3-trimethyl-6-methylsulfanylcarbothioylsulfanylheptanoyl]amino]propoxy]-2,2-dimethylpropyl]carbamate |
| SMILES | CSC(=S)SC(C)CC(C(O)NCCOCCN=[N+]=[N-])C(C)C(C)(C)C(=O)NCCCOCC(C)(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H58N6O6S3/c1-21(45-27(43)44-10)18-23(24(37)32-13-16-40-17-14-35-36-31)22(2)30(8,9)25(38)33-12-11-15-41-20-29(6,7)19-34-26(39)42-28(3,4)5/h21-24,32,37H,11-20H2,1-10H3,(H,33,38)(H,34,39) |
| InChIKey | QMVGKPYEJCUACK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 166.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.03 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|