C23H42N8O8 — CID 165055007
tert-butyl N-[8-[2-(2-azidoethoxy)ethoxy]-1-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-1,5-dioxooctan-3-yl]carbamate (PubChem CID 165055007) has the molecular formula C23H42N8O8 and a molecular weight of 558.64 g/mol. Its IUPAC name is tert-butyl N-[8-[2-(2-azidoethoxy)ethoxy]-1-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-1,5-dioxooctan-3-yl]carbamate.
| Compound Name | tert-butyl N-[8-[2-(2-azidoethoxy)ethoxy]-1-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-1,5-dioxooctan-3-yl]carbamate |
|---|---|
| PubChem CID | 165055007 |
| Molecular Formula | C23H42N8O8 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | tert-butyl N-[8-[2-(2-azidoethoxy)ethoxy]-1-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-1,5-dioxooctan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)CCCOCCOCCN=[N+]=[N-])CC(=O)NCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C23H42N8O8/c1-23(2,3)39-22(34)29-19(17-20(32)5-4-9-35-13-14-37-11-7-27-30-24)18-21(33)26-6-10-36-15-16-38-12-8-28-31-25/h19H,4-18H2,1-3H3,(H,26,33)(H,29,34) |
| InChIKey | ODHKRJUFMGNHHG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 218.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|