C21H40N4O6 — CID 161302032
tert-butyl N-[(5S)-9-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-5-methyl-6-oxononyl]carbamate (PubChem CID 161302032) has the molecular formula C21H40N4O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is tert-butyl N-[(5S)-9-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-5-methyl-6-oxononyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-9-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-5-methyl-6-oxononyl]carbamate |
|---|---|
| PubChem CID | 161302032 |
| Molecular Formula | C21H40N4O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | tert-butyl N-[(5S)-9-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-5-methyl-6-oxononyl]carbamate |
| SMILES | C[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)CCCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C21H40N4O6/c1-18(8-5-6-10-23-20(27)31-21(2,3)4)19(26)9-7-12-28-14-16-30-17-15-29-13-11-24-25-22/h18H,5-17H2,1-4H3,(H,23,27)/t18-/m0/s1 |
| InChIKey | VHTCOBWVPZIEIA-SFHVURJKSA-N |
| XLogP | 4.03 |
| TPSA | 131.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|