C37H60N6O10 — CID 162224366
tert-butyl (2R,5S)-5-[3-[2-(2-azidoethoxy)ethoxy]propanoylamino]-9-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-2-[4-(phenylmethoxycarbonylamino)butyl]nonanoate (PubChem CID 162224366) has the molecular formula C37H60N6O10 and a molecular weight of 748.92 g/mol. Its IUPAC name is tert-butyl (2R,5S)-5-[3-[2-(2-azidoethoxy)ethoxy]propanoylamino]-9-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-2-[4-(phenylmethoxycarbonylamino)butyl]nonanoate.
| Compound Name | tert-butyl (2R,5S)-5-[3-[2-(2-azidoethoxy)ethoxy]propanoylamino]-9-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-2-[4-(phenylmethoxycarbonylamino)butyl]nonanoate |
|---|---|
| PubChem CID | 162224366 |
| Molecular Formula | C37H60N6O10 |
| Molecular Weight | 748.92 g/mol |
| Exact Mass | 748.44 |
| IUPAC Name | tert-butyl (2R,5S)-5-[3-[2-(2-azidoethoxy)ethoxy]propanoylamino]-9-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-2-[4-(phenylmethoxycarbonylamino)butyl]nonanoate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)CCOCCOCCN=[N+]=[N-])C(=O)C[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H60N6O10/c1-36(2,3)52-33(46)29(16-10-12-19-39-34(47)51-27-28-14-8-7-9-15-28)26-31(44)30(17-11-13-20-40-35(48)53-37(4,5)6)42-32(45)18-22-49-24-25-50-23-21-41-43-38/h7-9,14-15,29-30H,10-13,16-27H2,1-6H3,(H,39,47)(H,40,48)(H,42,45)/t29-,30+/m1/s1 |
| InChIKey | ZUNZSMBGGJPJPG-IHLOFXLRSA-N |
| XLogP | 5.91 |
| TPSA | 216.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.92 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|