C38H56N2O11 — CID 158029388
tert-butyl 3-[2-[2-[2-[(5S)-4-oxo-5,9-bis(phenylmethoxycarbonylamino)nonoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 158029388) has the molecular formula C38H56N2O11 and a molecular weight of 716.87 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[2-[(5S)-4-oxo-5,9-bis(phenylmethoxycarbonylamino)nonoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[2-[(5S)-4-oxo-5,9-bis(phenylmethoxycarbonylamino)nonoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 158029388 |
| Molecular Formula | C38H56N2O11 |
| Molecular Weight | 716.87 g/mol |
| Exact Mass | 716.39 |
| IUPAC Name | tert-butyl 3-[2-[2-[2-[(5S)-4-oxo-5,9-bis(phenylmethoxycarbonylamino)nonoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCCC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H56N2O11/c1-38(2,3)51-35(42)19-22-46-24-26-48-28-27-47-25-23-45-21-12-18-34(41)33(40-37(44)50-30-32-15-8-5-9-16-32)17-10-11-20-39-36(43)49-29-31-13-6-4-7-14-31/h4-9,13-16,33H,10-12,17-30H2,1-3H3,(H,39,43)(H,40,44)/t33-/m0/s1 |
| InChIKey | MSEDVRPAHGANKT-XIFFEERXSA-N |
| XLogP | 5.53 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.87 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|