C41H63N7O6 — CID 10842756
benzyl N-[(5S)-5-[[(2S)-2-(11-azidoundecanoylamino)-3-phenylmethoxypropanoyl]amino]-6-(3,3-dimethylbutylamino)-6-oxohexyl]carbamate (PubChem CID 10842756) has the molecular formula C41H63N7O6 and a molecular weight of 750.00 g/mol. Its IUPAC name is benzyl N-[(5S)-5-[[(2S)-2-(11-azidoundecanoylamino)-3-phenylmethoxypropanoyl]amino]-6-(3,3-dimethylbutylamino)-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-[[(2S)-2-(11-azidoundecanoylamino)-3-phenylmethoxypropanoyl]amino]-6-(3,3-dimethylbutylamino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 10842756 |
| Molecular Formula | C41H63N7O6 |
| Molecular Weight | 750.00 g/mol |
| Exact Mass | 749.48 |
| IUPAC Name | benzyl N-[(5S)-5-[[(2S)-2-(11-azidoundecanoylamino)-3-phenylmethoxypropanoyl]amino]-6-(3,3-dimethylbutylamino)-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)CCNC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)[C@H](COCc1ccccc1)NC(=O)CCCCCCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C41H63N7O6/c1-41(2,3)26-29-43-38(50)35(24-17-19-27-44-40(52)54-31-34-22-14-11-15-23-34)47-39(51)36(32-53-30-33-20-12-10-13-21-33)46-37(49)25-16-8-6-4-5-7-9-18-28-45-48-42/h10-15,20-23,35-36H,4-9,16-19,24-32H2,1-3H3,(H,43,50)(H,44,52)(H,46,49)(H,47,51)/t35-,36-/m0/s1 |
| InChIKey | HPSSQDMZHWIWJK-ZPGRZCPFSA-N |
| XLogP | 7.64 |
| TPSA | 183.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.00 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|