C28H51N9O9 — CID 175464018
tert-butyl 6-[3-[2-(2-azidoethoxy)ethoxy]propanoylamino]-2-[4-[3-[2-(2-azidoethoxy)ethoxy]propanoylamino]butanoylamino]hexanoate (PubChem CID 175464018) has the molecular formula C28H51N9O9 and a molecular weight of 657.77 g/mol. Its IUPAC name is tert-butyl 6-[3-[2-(2-azidoethoxy)ethoxy]propanoylamino]-2-[4-[3-[2-(2-azidoethoxy)ethoxy]propanoylamino]butanoylamino]hexanoate.
| Compound Name | tert-butyl 6-[3-[2-(2-azidoethoxy)ethoxy]propanoylamino]-2-[4-[3-[2-(2-azidoethoxy)ethoxy]propanoylamino]butanoylamino]hexanoate |
|---|---|
| PubChem CID | 175464018 |
| Molecular Formula | C28H51N9O9 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.38 |
| IUPAC Name | tert-butyl 6-[3-[2-(2-azidoethoxy)ethoxy]propanoylamino]-2-[4-[3-[2-(2-azidoethoxy)ethoxy]propanoylamino]butanoylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)C(CCCCNC(=O)CCOCCOCCN=[N+]=[N-])NC(=O)CCCNC(=O)CCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C28H51N9O9/c1-28(2,3)46-27(41)23(7-4-5-11-31-24(38)9-15-42-19-21-44-17-13-33-36-29)35-26(40)8-6-12-32-25(39)10-16-43-20-22-45-18-14-34-37-30/h23H,4-22H2,1-3H3,(H,31,38)(H,32,39)(H,35,40) |
| InChIKey | UJDDIODDRFITCP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 248.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|