C38H57F5N10O10 — CID 170094947
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[[(2S)-7-(5-azidopentanoylamino)-2-[4-(5-azidopentanoylamino)butanoylamino]heptanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 170094947) has the molecular formula C38H57F5N10O10 and a molecular weight of 908.92 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[[(2S)-7-(5-azidopentanoylamino)-2-[4-(5-azidopentanoylamino)butanoylamino]heptanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[[(2S)-7-(5-azidopentanoylamino)-2-[4-(5-azidopentanoylamino)butanoylamino]heptanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 170094947 |
| Molecular Formula | C38H57F5N10O10 |
| Molecular Weight | 908.92 g/mol |
| Exact Mass | 908.42 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[[(2S)-7-(5-azidopentanoylamino)-2-[4-(5-azidopentanoylamino)butanoylamino]heptanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | [N-]=[N+]=NCCCCC(=O)NCCCCC[C@H](NC(=O)CCCNC(=O)CCCCN=[N+]=[N-])C(=O)NCCOCCOCCOCCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C38H57F5N10O10/c39-32-33(40)35(42)37(36(43)34(32)41)63-31(57)13-19-59-21-23-61-25-26-62-24-22-60-20-18-48-38(58)27(9-2-1-5-14-46-28(54)10-3-6-16-49-52-44)51-30(56)12-8-15-47-29(55)11-4-7-17-50-53-45/h27H,1-26H2,(H,46,54)(H,47,55)(H,48,58)(H,51,56)/t27-/m0/s1 |
| InChIKey | FXLPUQIXHSWMHH-MHZLTWQESA-N |
| XLogP | 4.88 |
| TPSA | 277.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.92 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|