C32H59N8O10+ — CID 178103536
[5-[[(5S)-6-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-5-[4-[5-(methylideneamino)pentanoylamino]butanoylamino]-6-oxohexyl]amino]-5-oxopentyl]imino-iminoazanium (PubChem CID 178103536) has the molecular formula C32H59N8O10+ and a molecular weight of 715.87 g/mol. Its IUPAC name is [5-[[(5S)-6-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-5-[4-[5-(methylideneamino)pentanoylamino]butanoylamino]-6-oxohexyl]amino]-5-oxopentyl]imino-iminoazanium.
| Compound Name | [5-[[(5S)-6-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-5-[4-[5-(methylideneamino)pentanoylamino]butanoylamino]-6-oxohexyl]amino]-5-oxopentyl]imino-iminoazanium |
|---|---|
| PubChem CID | 178103536 |
| Molecular Formula | C32H59N8O10+ |
| Molecular Weight | 715.87 g/mol |
| Exact Mass | 715.43 |
| IUPAC Name | [5-[[(5S)-6-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-5-[4-[5-(methylideneamino)pentanoylamino]butanoylamino]-6-oxohexyl]amino]-5-oxopentyl]imino-iminoazanium |
| SMILES | C=NCCCCC(=O)NCCCC(=O)N[C@@H](CCCCNC(=O)CCCCN=[N+]=N)C(=O)NCCOCCOCCOCCOCCC(=O)O |
| InChI | InChI=1S/C32H58N8O10/c1-34-14-5-3-10-29(42)36-16-8-12-30(43)39-27(9-2-6-15-35-28(41)11-4-7-17-38-40-33)32(46)37-18-20-48-22-24-50-26-25-49-23-21-47-19-13-31(44)45/h27,33H,1-26H2,(H4-,35,36,37,39,41,42,43,44,45,46)/p+1/t27-/m0/s1 |
| InChIKey | CNPKJLYCCWZUFS-MHZLTWQESA-O |
| XLogP | 0.90 |
| TPSA | 253.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.87 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|