C27H52N4O8 — CID 174198375
(2S)-2-(hexanoylamino)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N'-[4-(propanoylamino)butyl]pentanediamide (PubChem CID 174198375) has the molecular formula C27H52N4O8 and a molecular weight of 560.73 g/mol. Its IUPAC name is (2S)-2-(hexanoylamino)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N'-[4-(propanoylamino)butyl]pentanediamide.
| Compound Name | (2S)-2-(hexanoylamino)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N'-[4-(propanoylamino)butyl]pentanediamide |
|---|---|
| PubChem CID | 174198375 |
| Molecular Formula | C27H52N4O8 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.38 |
| IUPAC Name | (2S)-2-(hexanoylamino)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N'-[4-(propanoylamino)butyl]pentanediamide |
| SMILES | CCCCCC(=O)N[C@@H](CCC(=O)NCCCCNC(=O)CC)C(=O)NCCOCCOCCOCCOC |
| InChI | InChI=1S/C27H52N4O8/c1-4-6-7-10-26(34)31-23(11-12-25(33)29-14-9-8-13-28-24(32)5-2)27(35)30-15-16-37-19-20-39-22-21-38-18-17-36-3/h23H,4-22H2,1-3H3,(H,28,32)(H,29,33)(H,30,35)(H,31,34)/t23-/m0/s1 |
| InChIKey | JVJBTENMUXMVFD-QHCPKHFHSA-N |
| XLogP | 1.07 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|