C27H38F5N5O8 — CID 175632240
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[[(2S)-6-azido-2-(butanoylamino)hexanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 175632240) has the molecular formula C27H38F5N5O8 and a molecular weight of 655.62 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[[(2S)-6-azido-2-(butanoylamino)hexanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[[(2S)-6-azido-2-(butanoylamino)hexanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 175632240 |
| Molecular Formula | C27H38F5N5O8 |
| Molecular Weight | 655.62 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[[(2S)-6-azido-2-(butanoylamino)hexanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CCCC(=O)N[C@@H](CCCCN=[N+]=[N-])C(=O)NCCOCCOCCOCCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C27H38F5N5O8/c1-2-5-19(38)36-18(6-3-4-8-35-37-33)27(40)34-9-11-42-13-15-44-17-16-43-14-12-41-10-7-20(39)45-26-24(31)22(29)21(28)23(30)25(26)32/h18H,2-17H2,1H3,(H,34,40)(H,36,38)/t18-/m0/s1 |
| InChIKey | SLOZDZVXBFFECG-SFHVURJKSA-N |
| XLogP | 3.63 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|