C22H31F5N2O8 — CID 166480186
(2,3,4,5,6-pentafluorophenyl) 3-[2-[3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-3-oxopropoxy]ethoxy]propanoate (PubChem CID 166480186) has the molecular formula C22H31F5N2O8 and a molecular weight of 546.49 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[2-[3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-3-oxopropoxy]ethoxy]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-3-oxopropoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 166480186 |
| Molecular Formula | C22H31F5N2O8 |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-3-oxopropoxy]ethoxy]propanoate |
| SMILES | NCCOCCOCCOCCNC(=O)CCOCCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H31F5N2O8/c23-17-18(24)20(26)22(21(27)19(17)25)37-16(31)2-6-33-10-9-32-5-1-15(30)29-4-8-35-12-14-36-13-11-34-7-3-28/h1-14,28H2,(H,29,30) |
| InChIKey | ZECCDVIKXUKUSF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|