C35H49F4NO6 — CID 171841642
(2,3,5,6-tetrafluorophenyl) 3-[2-[2-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 171841642) has the molecular formula C35H49F4NO6 and a molecular weight of 655.77 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 3-[2-[2-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 3-[2-[2-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 171841642 |
| Molecular Formula | C35H49F4NO6 |
| Molecular Weight | 655.77 g/mol |
| Exact Mass | 655.35 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 3-[2-[2-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCOCCOCCOCCC(=O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C35H49F4NO6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-31(41)40-21-23-44-25-27-45-26-24-43-22-20-32(42)46-35-33(38)29(36)28-30(37)34(35)39/h6-7,9-10,12-13,15-16,28H,2-5,8,11,14,17-27H2,1H3,(H,40,41)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | DCEDJFLUIZDEHM-DOFZRALJSA-N |
| XLogP | 7.85 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.77 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|