C29H53N2O4P — CID 154645597
(5Z,8Z,11Z,14Z)-N-[2-[3-[methyl-[2-(methylamino)ethoxy]phosphanyl]oxypropoxy]ethyl]icosa-5,8,11,14-tetraenamide (PubChem CID 154645597) has the molecular formula C29H53N2O4P and a molecular weight of 524.73 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-[2-[3-[methyl-[2-(methylamino)ethoxy]phosphanyl]oxypropoxy]ethyl]icosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-[2-[3-[methyl-[2-(methylamino)ethoxy]phosphanyl]oxypropoxy]ethyl]icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 154645597 |
| Molecular Formula | C29H53N2O4P |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-[2-[3-[methyl-[2-(methylamino)ethoxy]phosphanyl]oxypropoxy]ethyl]icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCOCCCOP(C)OCCNC |
| InChI | InChI=1S/C29H53N2O4P/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-29(32)31-24-27-33-25-21-26-34-36(3)35-28-23-30-2/h8-9,11-12,14-15,17-18,30H,4-7,10,13,16,19-28H2,1-3H3,(H,31,32)/b9-8-,12-11-,15-14-,18-17- |
| InChIKey | DKROZWWJMRTVHA-GKFVBPDJSA-N |
| XLogP | 6.85 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|