C24H27F4N3O8 — CID 170128204
(2,3,5,6-tetrafluorophenyl) 3-[3-[3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]propanoylamino]propoxy]propanoate (PubChem CID 170128204) has the molecular formula C24H27F4N3O8 and a molecular weight of 561.49 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 3-[3-[3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]propanoylamino]propoxy]propanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 3-[3-[3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]propanoylamino]propoxy]propanoate |
|---|---|
| PubChem CID | 170128204 |
| Molecular Formula | C24H27F4N3O8 |
| Molecular Weight | 561.49 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 3-[3-[3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]propanoylamino]propoxy]propanoate |
| SMILES | O=C(CCOCCNC(=O)CCN1C(=O)C=CC1=O)NCCCOCCC(=O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C24H27F4N3O8/c25-15-14-16(26)23(28)24(22(15)27)39-21(36)6-12-37-10-1-7-29-18(33)5-11-38-13-8-30-17(32)4-9-31-19(34)2-3-20(31)35/h2-3,14H,1,4-13H2,(H,29,33)(H,30,32) |
| InChIKey | NQZIEAZFTYLJFM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.49 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|