C25H35N3O9 — CID 129133191
3-(2,5-dioxocyclopent-3-en-1-yl)-N-[3-[2-[2-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]ethoxy]ethoxy]propyl]propanamide (PubChem CID 129133191) has the molecular formula C25H35N3O9 and a molecular weight of 521.57 g/mol. Its IUPAC name is 3-(2,5-dioxocyclopent-3-en-1-yl)-N-[3-[2-[2-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]ethoxy]ethoxy]propyl]propanamide.
| Compound Name | 3-(2,5-dioxocyclopent-3-en-1-yl)-N-[3-[2-[2-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]ethoxy]ethoxy]propyl]propanamide |
|---|---|
| PubChem CID | 129133191 |
| Molecular Formula | C25H35N3O9 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 3-(2,5-dioxocyclopent-3-en-1-yl)-N-[3-[2-[2-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]ethoxy]ethoxy]propyl]propanamide |
| SMILES | O=C(CCC1C(=O)C=CC1=O)NCCCOCCOCCOCCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C25H35N3O9/c29-20-4-5-21(30)19(20)3-6-22(31)26-10-1-13-35-15-17-37-18-16-36-14-2-11-27-23(32)9-12-28-24(33)7-8-25(28)34/h4-5,7-8,19H,1-3,6,9-18H2,(H,26,31)(H,27,32) |
| InChIKey | XXIQWMFIZFUNIP-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|