C25H45N3O6 — CID 144554334
3-(2,5-dioxopyrrol-1-yl)-N-[3-[2-[2-[3-(2,2,3,3-tetramethylbutylamino)propoxy]ethoxy]ethoxy]propyl]propanamide (PubChem CID 144554334) has the molecular formula C25H45N3O6 and a molecular weight of 483.65 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[3-[2-[2-[3-(2,2,3,3-tetramethylbutylamino)propoxy]ethoxy]ethoxy]propyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[3-[2-[2-[3-(2,2,3,3-tetramethylbutylamino)propoxy]ethoxy]ethoxy]propyl]propanamide |
|---|---|
| PubChem CID | 144554334 |
| Molecular Formula | C25H45N3O6 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.33 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[3-[2-[2-[3-(2,2,3,3-tetramethylbutylamino)propoxy]ethoxy]ethoxy]propyl]propanamide |
| SMILES | CC(C)(C)C(C)(C)CNCCCOCCOCCOCCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C25H45N3O6/c1-24(2,3)25(4,5)20-26-11-6-14-32-16-18-34-19-17-33-15-7-12-27-21(29)10-13-28-22(30)8-9-23(28)31/h8-9,26H,6-7,10-20H2,1-5H3,(H,27,29) |
| InChIKey | APIRJLKKQXFSFG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|