C21H34N2O6S — CID 147804335
N-[2-[2-(6-tert-butylsulfanyl-4-oxohexoxy)ethoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 147804335) has the molecular formula C21H34N2O6S and a molecular weight of 442.58 g/mol. Its IUPAC name is N-[2-[2-(6-tert-butylsulfanyl-4-oxohexoxy)ethoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-[2-[2-(6-tert-butylsulfanyl-4-oxohexoxy)ethoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 147804335 |
| Molecular Formula | C21H34N2O6S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[2-[2-(6-tert-butylsulfanyl-4-oxohexoxy)ethoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | CC(C)(C)SCCC(=O)CCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H34N2O6S/c1-21(2,3)30-16-9-17(24)5-4-12-28-14-15-29-13-10-22-18(25)8-11-23-19(26)6-7-20(23)27/h6-7H,4-5,8-16H2,1-3H3,(H,22,25) |
| InChIKey | HMCVLIMGRGGXIO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|