C36H58N2O13 — CID 159047217
[2,2-bis(2,2-dimethylpropanoyloxymethyl)-3-[5-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]-2-oxopentoxy]propyl] 2,2-dimethylpropanoate (PubChem CID 159047217) has the molecular formula C36H58N2O13 and a molecular weight of 726.86 g/mol. Its IUPAC name is [2,2-bis(2,2-dimethylpropanoyloxymethyl)-3-[5-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]-2-oxopentoxy]propyl] 2,2-dimethylpropanoate.
| Compound Name | [2,2-bis(2,2-dimethylpropanoyloxymethyl)-3-[5-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]-2-oxopentoxy]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 159047217 |
| Molecular Formula | C36H58N2O13 |
| Molecular Weight | 726.86 g/mol |
| Exact Mass | 726.39 |
| IUPAC Name | [2,2-bis(2,2-dimethylpropanoyloxymethyl)-3-[5-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]-2-oxopentoxy]propyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC(COCC(=O)CCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O)(COC(=O)C(C)(C)C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C36H58N2O13/c1-33(2,3)30(43)49-23-36(24-50-31(44)34(4,5)6,25-51-32(45)35(7,8)9)22-48-21-26(39)11-10-17-46-19-20-47-18-15-37-27(40)14-16-38-28(41)12-13-29(38)42/h12-13H,10-11,14-25H2,1-9H3,(H,37,40) |
| InChIKey | JWUPVHABAGDFGF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 190.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.86 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|