C31H40N4O10 — CID 122551869
N-[2-[2,2-bis(but-3-ynoxymethyl)-3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]propoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 122551869) has the molecular formula C31H40N4O10 and a molecular weight of 628.68 g/mol. Its IUPAC name is N-[2-[2,2-bis(but-3-ynoxymethyl)-3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]propoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-[2-[2,2-bis(but-3-ynoxymethyl)-3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]propoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 122551869 |
| Molecular Formula | C31H40N4O10 |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | N-[2-[2,2-bis(but-3-ynoxymethyl)-3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]propoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | C#CCCOCC(COCCC#C)(COCCNC(=O)CCN1C(=O)C=CC1=O)COCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C31H40N4O10/c1-3-5-17-42-21-31(22-43-18-6-4-2,23-44-19-13-32-25(36)11-15-34-27(38)7-8-28(34)39)24-45-20-14-33-26(37)12-16-35-29(40)9-10-30(35)41/h1-2,7-10H,5-6,11-24H2,(H,32,36)(H,33,37) |
| InChIKey | WYOVTQDDCVKLLL-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 169.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|