C20H30N2O6 — CID 157450019
N-[2-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]ethyl]pent-4-ynamide;methane (PubChem CID 157450019) has the molecular formula C20H30N2O6 and a molecular weight of 394.47 g/mol. Its IUPAC name is N-[2-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]ethyl]pent-4-ynamide;methane.
| Compound Name | N-[2-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]ethyl]pent-4-ynamide;methane |
|---|---|
| PubChem CID | 157450019 |
| Molecular Formula | C20H30N2O6 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | N-[2-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]ethyl]pent-4-ynamide;methane |
| SMILES | C.C#CCCC(=O)NCCOCCOCCCC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H26N2O6.CH4/c1-2-3-6-17(23)20-10-13-27-15-14-26-12-4-5-16(22)9-11-21-18(24)7-8-19(21)25;/h1,7-8H,3-6,9-15H2,(H,20,23);1H4 |
| InChIKey | BSROEESDJUSLKU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|