C20H33N3O5 — CID 58114207
3-(2,5-dioxopyrrol-1-yl)-N-[2-[6-[[(2R)-3-methylbutan-2-yl]amino]-3-oxohexoxy]ethyl]propanamide (PubChem CID 58114207) has the molecular formula C20H33N3O5 and a molecular weight of 395.50 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-[6-[[(2R)-3-methylbutan-2-yl]amino]-3-oxohexoxy]ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[6-[[(2R)-3-methylbutan-2-yl]amino]-3-oxohexoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 58114207 |
| Molecular Formula | C20H33N3O5 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[6-[[(2R)-3-methylbutan-2-yl]amino]-3-oxohexoxy]ethyl]propanamide |
| SMILES | CC(C)[C@@H](C)NCCCC(=O)CCOCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H33N3O5/c1-15(2)16(3)21-10-4-5-17(24)9-13-28-14-11-22-18(25)8-12-23-19(26)6-7-20(23)27/h6-7,15-16,21H,4-5,8-14H2,1-3H3,(H,22,25)/t16-/m1/s1 |
| InChIKey | WZEVJNNHKVMUFP-MRXNPFEDSA-N |
| XLogP | 0.81 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|