C12H10F5N3O2 — CID 163715517
(2,3,4,5,6-pentafluorophenyl) 6-azidohexanoate (PubChem CID 163715517) has the molecular formula C12H10F5N3O2 and a molecular weight of 323.22 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 6-azidohexanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 6-azidohexanoate |
|---|---|
| PubChem CID | 163715517 |
| Molecular Formula | C12H10F5N3O2 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 6-azidohexanoate |
| SMILES | [N-]=[N+]=NCCCCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H10F5N3O2/c13-7-8(14)10(16)12(11(17)9(7)15)22-6(21)4-2-1-3-5-19-20-18/h1-5H2 |
| InChIKey | KMZJGPWXVVZUEM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|