About 6-azidohexanoyl chloride
6-azidohexanoyl chloride (PubChem CID 14580383) has the molecular formula C6H10ClN3O
and a molecular weight of 175.62 g/mol. Its IUPAC name is 6-azidohexanoyl chloride.
Molecular Properties
| Compound Name | 6-azidohexanoyl chloride |
| PubChem CID | 14580383 |
| Molecular Formula | C6H10ClN3O |
| Molecular Weight | 175.62 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 6-azidohexanoyl chloride |
| SMILES | [N-]=[N+]=NCCCCCC(=O)Cl |
| InChI | InChI=1S/C6H10ClN3O/c7-6(11)4-2-1-3-5-9-10-8/h1-5H2 |
| InChIKey | XJNLPJYSEYKBBY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-azidohexanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azidohexanoyl chloride?
The IUPAC name of 6-azidohexanoyl chloride (CID 14580383) is 6-azidohexanoyl chloride.
What is the SMILES notation for 6-azidohexanoyl chloride?
The canonical SMILES for 6-azidohexanoyl chloride is [N-]=[N+]=NCCCCCC(=O)Cl.
What is the InChIKey of 6-azidohexanoyl chloride?
The InChIKey is XJNLPJYSEYKBBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10ClN3O/c7-6(11)4-2-1-3-5-9-10-8/h1-5H2.
What are the key properties of 6-azidohexanoyl chloride?
6-azidohexanoyl chloride has a molecular weight of 175.62 g/mol, XLogP of 2.62, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azidohexanoyl chloride is sourced from PubChem (CID 14580383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).