About 9-aminononanoic acid;9-azidononanoic acid
9-aminononanoic acid;9-azidononanoic acid (PubChem CID 159969853) has the molecular formula C18H36N4O4
and a molecular weight of 372.51 g/mol. Its IUPAC name is 9-aminononanoic acid;9-azidononanoic acid.
Molecular Properties
| Compound Name | 9-aminononanoic acid;9-azidononanoic acid |
| PubChem CID | 159969853 |
| Molecular Formula | C18H36N4O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 9-aminononanoic acid;9-azidononanoic acid |
| SMILES | NCCCCCCCCC(=O)O.[N-]=[N+]=NCCCCCCCCC(=O)O |
| InChI | InChI=1S/C9H17N3O2.C9H19NO2/c10-12-11-8-6-4-2-1-3-5-7-9(13)14;10-8-6-4-2-1-3-5-7-9(11)12/h1-8H2,(H,13,14);1-8,10H2,(H,11,12) |
| InChIKey | OEKFNKQOCHPYAT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 149.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 9-aminononanoic acid;9-azidononanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-aminononanoic acid;9-azidononanoic acid?
The IUPAC name of 9-aminononanoic acid;9-azidononanoic acid (CID 159969853) is 9-aminononanoic acid;9-azidononanoic acid.
What is the SMILES notation for 9-aminononanoic acid;9-azidononanoic acid?
The canonical SMILES for 9-aminononanoic acid;9-azidononanoic acid is NCCCCCCCCC(=O)O.[N-]=[N+]=NCCCCCCCCC(=O)O.
What is the InChIKey of 9-aminononanoic acid;9-azidononanoic acid?
The InChIKey is OEKFNKQOCHPYAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2.C9H19NO2/c10-12-11-8-6-4-2-1-3-5-7-9(13)14;10-8-6-4-2-1-3-5-7-9(11)12/h1-8H2,(H,13,14);1-8,10H2,(H,11,12).
What are the key properties of 9-aminononanoic acid;9-azidononanoic acid?
9-aminononanoic acid;9-azidononanoic acid has a molecular weight of 372.51 g/mol, XLogP of 4.87, 17 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-aminononanoic acid;9-azidononanoic acid is sourced from PubChem (CID 159969853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).