C13H28N2O4 — CID 174639050
heptanedioic acid;hexane-1,6-diamine (PubChem CID 174639050) has the molecular formula C13H28N2O4 and a molecular weight of 276.38 g/mol. Its IUPAC name is heptanedioic acid;hexane-1,6-diamine.
| Compound Name | heptanedioic acid;hexane-1,6-diamine |
|---|---|
| PubChem CID | 174639050 |
| Molecular Formula | C13H28N2O4 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | heptanedioic acid;hexane-1,6-diamine |
| SMILES | NCCCCCCN.O=C(O)CCCCCC(=O)O |
| InChI | InChI=1S/C7H12O4.C6H16N2/c8-6(9)4-2-1-3-5-7(10)11;7-5-3-1-2-4-6-8/h1-5H2,(H,8,9)(H,10,11);1-8H2 |
| InChIKey | WRMVKLMATZRVKW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|