About 14-azidotetradecane-2,5-dione
14-azidotetradecane-2,5-dione (PubChem CID 135040428) has the molecular formula C14H25N3O2
and a molecular weight of 267.37 g/mol. Its IUPAC name is 14-azidotetradecane-2,5-dione.
Molecular Properties
| Compound Name | 14-azidotetradecane-2,5-dione |
| PubChem CID | 135040428 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 14-azidotetradecane-2,5-dione |
| SMILES | CC(=O)CCC(=O)CCCCCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C14H25N3O2/c1-13(18)10-11-14(19)9-7-5-3-2-4-6-8-12-16-17-15/h2-12H2,1H3 |
| InChIKey | KGRRJMKLVPAALR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 14-azidotetradecane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-azidotetradecane-2,5-dione?
The IUPAC name of 14-azidotetradecane-2,5-dione (CID 135040428) is 14-azidotetradecane-2,5-dione.
What is the SMILES notation for 14-azidotetradecane-2,5-dione?
The canonical SMILES for 14-azidotetradecane-2,5-dione is CC(=O)CCC(=O)CCCCCCCCCN=[N+]=[N-].
What is the InChIKey of 14-azidotetradecane-2,5-dione?
The InChIKey is KGRRJMKLVPAALR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O2/c1-13(18)10-11-14(19)9-7-5-3-2-4-6-8-12-16-17-15/h2-12H2,1H3.
What are the key properties of 14-azidotetradecane-2,5-dione?
14-azidotetradecane-2,5-dione has a molecular weight of 267.37 g/mol, XLogP of 4.36, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 14-azidotetradecane-2,5-dione is sourced from PubChem (CID 135040428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).