About 16-azidohexadecan-2-one
16-azidohexadecan-2-one (PubChem CID 56624829) has the molecular formula C16H31N3O
and a molecular weight of 281.44 g/mol. Its IUPAC name is 16-azidohexadecan-2-one.
Molecular Properties
| Compound Name | 16-azidohexadecan-2-one |
| PubChem CID | 56624829 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | 16-azidohexadecan-2-one |
| SMILES | CC(=O)CCCCCCCCCCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C16H31N3O/c1-16(20)14-12-10-8-6-4-2-3-5-7-9-11-13-15-18-19-17/h2-15H2,1H3 |
| InChIKey | XCQJSDGCWZELQT-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 16-azidohexadecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 16-azidohexadecan-2-one?
The IUPAC name of 16-azidohexadecan-2-one (CID 56624829) is 16-azidohexadecan-2-one.
What is the SMILES notation for 16-azidohexadecan-2-one?
The canonical SMILES for 16-azidohexadecan-2-one is CC(=O)CCCCCCCCCCCCCCN=[N+]=[N-].
What is the InChIKey of 16-azidohexadecan-2-one?
The InChIKey is XCQJSDGCWZELQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3O/c1-16(20)14-12-10-8-6-4-2-3-5-7-9-11-13-15-18-19-17/h2-15H2,1H3.
What are the key properties of 16-azidohexadecan-2-one?
16-azidohexadecan-2-one has a molecular weight of 281.44 g/mol, XLogP of 5.96, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 16-azidohexadecan-2-one is sourced from PubChem (CID 56624829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).