C7H10F3N3O — CID 150586806
7-azido-1,1,1-trifluoroheptan-2-one (PubChem CID 150586806) has the molecular formula C7H10F3N3O and a molecular weight of 209.17 g/mol. Its IUPAC name is 7-azido-1,1,1-trifluoroheptan-2-one.
| Compound Name | 7-azido-1,1,1-trifluoroheptan-2-one |
|---|---|
| PubChem CID | 150586806 |
| Molecular Formula | C7H10F3N3O |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 7-azido-1,1,1-trifluoroheptan-2-one |
| SMILES | [N-]=[N+]=NCCCCCC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H10F3N3O/c8-7(9,10)6(14)4-2-1-3-5-12-13-11/h1-5H2 |
| InChIKey | IPAFNCLYLJQLSA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|