About (2,3,5,6-tetrafluorophenyl) 2-azidoacetate
(2,3,5,6-tetrafluorophenyl) 2-azidoacetate (PubChem CID 155414947) has the molecular formula C8H3F4N3O2
and a molecular weight of 249.12 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 2-azidoacetate.
Molecular Properties
| Compound Name | (2,3,5,6-tetrafluorophenyl) 2-azidoacetate |
| PubChem CID | 155414947 |
| Molecular Formula | C8H3F4N3O2 |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 2-azidoacetate |
| SMILES | [N-]=[N+]=NCC(=O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C8H3F4N3O2/c9-3-1-4(10)7(12)8(6(3)11)17-5(16)2-14-15-13/h1H,2H2 |
| InChIKey | SGBBTRZDWMLOBL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,3,5,6-tetrafluorophenyl) 2-azidoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,5,6-tetrafluorophenyl) 2-azidoacetate?
The IUPAC name of (2,3,5,6-tetrafluorophenyl) 2-azidoacetate (CID 155414947) is (2,3,5,6-tetrafluorophenyl) 2-azidoacetate.
What is the SMILES notation for (2,3,5,6-tetrafluorophenyl) 2-azidoacetate?
The canonical SMILES for (2,3,5,6-tetrafluorophenyl) 2-azidoacetate is [N-]=[N+]=NCC(=O)Oc1c(F)c(F)cc(F)c1F.
What is the InChIKey of (2,3,5,6-tetrafluorophenyl) 2-azidoacetate?
The InChIKey is SGBBTRZDWMLOBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F4N3O2/c9-3-1-4(10)7(12)8(6(3)11)17-5(16)2-14-15-13/h1H,2H2.
What are the key properties of (2,3,5,6-tetrafluorophenyl) 2-azidoacetate?
(2,3,5,6-tetrafluorophenyl) 2-azidoacetate has a molecular weight of 249.12 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,5,6-tetrafluorophenyl) 2-azidoacetate is sourced from PubChem (CID 155414947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).