About (2-fluorophenyl) 2-aminoacetate
(2-fluorophenyl) 2-aminoacetate (PubChem CID 54234979) has the molecular formula C8H8FNO2
and a molecular weight of 169.15 g/mol. Its IUPAC name is (2-fluorophenyl) 2-aminoacetate.
Molecular Properties
| Compound Name | (2-fluorophenyl) 2-aminoacetate |
| PubChem CID | 54234979 |
| Molecular Formula | C8H8FNO2 |
| Molecular Weight | 169.15 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | (2-fluorophenyl) 2-aminoacetate |
| SMILES | NCC(=O)Oc1ccccc1F |
| InChI | InChI=1S/C8H8FNO2/c9-6-3-1-2-4-7(6)12-8(11)5-10/h1-4H,5,10H2 |
| InChIKey | QLWYYSOTBJMVFQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.15 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-fluorophenyl) 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl) 2-aminoacetate?
The IUPAC name of (2-fluorophenyl) 2-aminoacetate (CID 54234979) is (2-fluorophenyl) 2-aminoacetate.
What is the SMILES notation for (2-fluorophenyl) 2-aminoacetate?
The canonical SMILES for (2-fluorophenyl) 2-aminoacetate is NCC(=O)Oc1ccccc1F.
What is the InChIKey of (2-fluorophenyl) 2-aminoacetate?
The InChIKey is QLWYYSOTBJMVFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FNO2/c9-6-3-1-2-4-7(6)12-8(11)5-10/h1-4H,5,10H2.
What are the key properties of (2-fluorophenyl) 2-aminoacetate?
(2-fluorophenyl) 2-aminoacetate has a molecular weight of 169.15 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl) 2-aminoacetate is sourced from PubChem (CID 54234979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).