About phenyl 2-isocyanoacetate
phenyl 2-isocyanoacetate (PubChem CID 134966416) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is phenyl 2-isocyanoacetate.
Molecular Properties
| Compound Name | phenyl 2-isocyanoacetate |
| PubChem CID | 134966416 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | phenyl 2-isocyanoacetate |
| SMILES | [C-]#[N+]CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C9H7NO2/c1-10-7-9(11)12-8-5-3-2-4-6-8/h2-6H,7H2 |
| InChIKey | AVKUYCDWTWQLQQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-isocyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-isocyanoacetate?
The IUPAC name of phenyl 2-isocyanoacetate (CID 134966416) is phenyl 2-isocyanoacetate.
What is the SMILES notation for phenyl 2-isocyanoacetate?
The canonical SMILES for phenyl 2-isocyanoacetate is [C-]#[N+]CC(=O)Oc1ccccc1.
What is the InChIKey of phenyl 2-isocyanoacetate?
The InChIKey is AVKUYCDWTWQLQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c1-10-7-9(11)12-8-5-3-2-4-6-8/h2-6H,7H2.
What are the key properties of phenyl 2-isocyanoacetate?
phenyl 2-isocyanoacetate has a molecular weight of 161.16 g/mol, XLogP of 1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-isocyanoacetate is sourced from PubChem (CID 134966416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).