C22H41N11O8 — CID 177101607
(2S)-2-[[2-[2-[[2-(2-aminoethoxy)acetyl]amino]ethoxy]acetyl]amino]-6-[[2-(2-azidoethoxy)acetyl]amino]-N-[2-(2-azidoethoxy)ethyl]hexanamide (PubChem CID 177101607) has the molecular formula C22H41N11O8 and a molecular weight of 587.64 g/mol. Its IUPAC name is (2S)-2-[[2-[2-[[2-(2-aminoethoxy)acetyl]amino]ethoxy]acetyl]amino]-6-[[2-(2-azidoethoxy)acetyl]amino]-N-[2-(2-azidoethoxy)ethyl]hexanamide.
| Compound Name | (2S)-2-[[2-[2-[[2-(2-aminoethoxy)acetyl]amino]ethoxy]acetyl]amino]-6-[[2-(2-azidoethoxy)acetyl]amino]-N-[2-(2-azidoethoxy)ethyl]hexanamide |
|---|---|
| PubChem CID | 177101607 |
| Molecular Formula | C22H41N11O8 |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | (2S)-2-[[2-[2-[[2-(2-aminoethoxy)acetyl]amino]ethoxy]acetyl]amino]-6-[[2-(2-azidoethoxy)acetyl]amino]-N-[2-(2-azidoethoxy)ethyl]hexanamide |
| SMILES | [N-]=[N+]=NCCOCCNC(=O)[C@H](CCCCNC(=O)COCCN=[N+]=[N-])NC(=O)COCCNC(=O)COCCN |
| InChI | InChI=1S/C22H41N11O8/c23-4-10-39-15-20(35)27-6-12-40-17-21(36)31-18(22(37)28-7-11-38-13-8-29-32-24)3-1-2-5-26-19(34)16-41-14-9-30-33-25/h18H,1-17,23H2,(H,26,34)(H,27,35)(H,28,37)(H,31,36)/t18-/m0/s1 |
| InChIKey | ZQEQVYREMDMQBS-SFHVURJKSA-N |
| XLogP | -1.36 |
| TPSA | 276.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|