C32H61F3N10O9 — CID 157062468
6-amino-N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2-methylhexanamide;N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2-methyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide (PubChem CID 157062468) has the molecular formula C32H61F3N10O9 and a molecular weight of 786.89 g/mol. Its IUPAC name is 6-amino-N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2-methylhexanamide;N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2-methyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide.
| Compound Name | 6-amino-N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2-methylhexanamide;N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2-methyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
|---|---|
| PubChem CID | 157062468 |
| Molecular Formula | C32H61F3N10O9 |
| Molecular Weight | 786.89 g/mol |
| Exact Mass | 786.46 |
| IUPAC Name | 6-amino-N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2-methylhexanamide;N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2-methyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
| SMILES | CC(CCCCN)C(=O)NCCOCCOCCOCCN=[N+]=[N-].CC(CCCCNC(=O)C(F)(F)F)C(=O)NCCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C17H30F3N5O5.C15H31N5O4/c1-14(4-2-3-5-23-16(27)17(18,19)20)15(26)22-6-8-28-10-12-30-13-11-29-9-7-24-25-21;1-14(4-2-3-5-16)15(21)18-6-8-22-10-12-24-13-11-23-9-7-19-20-17/h14H,2-13H2,1H3,(H,22,26)(H,23,27);14H,2-13,16H2,1H3,(H,18,21) |
| InChIKey | ABMHNVCTIXEHIO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 266.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.89 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|