C18H34N8O10 — CID 129158118
(2S,3R,4S,5R)-N,N'-bis[2-[2-(2-azidoethoxy)ethoxy]ethyl]-2,3,4,5-tetrahydroxyhexanediamide (PubChem CID 129158118) has the molecular formula C18H34N8O10 and a molecular weight of 522.52 g/mol. Its IUPAC name is (2S,3R,4S,5R)-N,N'-bis[2-[2-(2-azidoethoxy)ethoxy]ethyl]-2,3,4,5-tetrahydroxyhexanediamide.
| Compound Name | (2S,3R,4S,5R)-N,N'-bis[2-[2-(2-azidoethoxy)ethoxy]ethyl]-2,3,4,5-tetrahydroxyhexanediamide |
|---|---|
| PubChem CID | 129158118 |
| Molecular Formula | C18H34N8O10 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | (2S,3R,4S,5R)-N,N'-bis[2-[2-(2-azidoethoxy)ethoxy]ethyl]-2,3,4,5-tetrahydroxyhexanediamide |
| SMILES | [N-]=[N+]=NCCOCCOCCNC(=O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)NCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C18H34N8O10/c19-25-23-3-7-35-11-9-33-5-1-21-17(31)15(29)13(27)14(28)16(30)18(32)22-2-6-34-10-12-36-8-4-24-26-20/h13-16,27-30H,1-12H2,(H,21,31)(H,22,32)/t13-,14+,15+,16- |
| InChIKey | FXPRFUZWJMKUHP-SYMSYNOKSA-N |
| XLogP | -2.65 |
| TPSA | 273.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|