C20H41N7O8 — CID 172639428
2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]ethanamine (PubChem CID 172639428) has the molecular formula C20H41N7O8 and a molecular weight of 507.59 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]ethanamine.
| Compound Name | 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]ethanamine |
|---|---|
| PubChem CID | 172639428 |
| Molecular Formula | C20H41N7O8 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]ethanamine |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCNCCOCCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C20H41N7O8/c21-26-24-3-7-30-11-15-34-19-17-32-13-9-28-5-1-23-2-6-29-10-14-33-18-20-35-16-12-31-8-4-25-27-22/h23H,1-20H2 |
| InChIKey | JNKYNFSOBSSGSG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 183.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|