C9H18N4O4 — CID 90113006
N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]formamide (PubChem CID 90113006) has the molecular formula C9H18N4O4 and a molecular weight of 246.27 g/mol. Its IUPAC name is N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]formamide.
| Compound Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]formamide |
|---|---|
| PubChem CID | 90113006 |
| Molecular Formula | C9H18N4O4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]formamide |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNC=O |
| InChI | InChI=1S/C9H18N4O4/c10-13-12-2-4-16-6-8-17-7-5-15-3-1-11-9-14/h9H,1-8H2,(H,11,14) |
| InChIKey | ZSXTZZNMHYSDPZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|