C12H24N4O6 — CID 166868754
2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]ethoxy]acetic acid (PubChem CID 166868754) has the molecular formula C12H24N4O6 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 166868754 |
| Molecular Formula | C12H24N4O6 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]ethoxy]acetic acid |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNCCOCC(=O)O |
| InChI | InChI=1S/C12H24N4O6/c13-16-15-3-6-20-8-10-21-9-7-19-4-1-14-2-5-22-11-12(17)18/h14H,1-11H2,(H,17,18) |
| InChIKey | MDVUISQNLCZFKX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|