C6H9N3O4 — CID 18798299
4-(2-azidoethoxy)-3-oxobutanoic acid (PubChem CID 18798299) has the molecular formula C6H9N3O4 and a molecular weight of 187.15 g/mol. Its IUPAC name is 4-(2-azidoethoxy)-3-oxobutanoic acid.
| Compound Name | 4-(2-azidoethoxy)-3-oxobutanoic acid |
|---|---|
| PubChem CID | 18798299 |
| Molecular Formula | C6H9N3O4 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 4-(2-azidoethoxy)-3-oxobutanoic acid |
| SMILES | [N-]=[N+]=NCCOCC(=O)CC(=O)O |
| InChI | InChI=1S/C6H9N3O4/c7-9-8-1-2-13-4-5(10)3-6(11)12/h1-4H2,(H,11,12) |
| InChIKey | XGAGKRZYKHVTKV-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|